On Target 5HT6R_HUMAN 0.34545454/CHEMBL1670
For the given ligand a, we have found in our database that, being scored 0.34545454, the most similar ligand is CHEMBL1670. Check out the elaboration below.
| a (Given Ligand) | CHEMBL1670 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | ClC(Cl)C(c1ccc(Cl)cc1)c2ccccc2Cl |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00028008 00000000 00000100 00010200 00000000 00000000 00000000 01000000 00000000 00080840 08000000 40048800 02000024 00000000 00000000 00000000 10000000 02000080 00000000 00000000 00000400 08000100 00000000 00400010 00002040 a8000200 00040000 40000080 00000080 00020002 04000000 00020400 |