On Target 5HT2C_HUMAN 0.40243903/CHEMBL1092167
For the given ligand a, we have found in our database that, being scored 0.40243903, the most similar ligand is CHEMBL1092167. Check out the elaboration below.
| a (Given Ligand) | CHEMBL1092167 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Clc1cc(Cl)cc(c1)c2ccc(CNC(=O)[C@@H]3CCCN3)cc2 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0001a000 01800000 00100100 04810600 00000000 00000030 04000000 22001000 00000100 000108c0 00200000 4001b800 86008816 00002400 80000400 00000000 00020000 02000000 04000000 10002201 80000000 38008720 10000001 02500018 00002000 c0000000 00000000 90000040 08004100 00060001 20044000 00020200 |