On Target GRM4_HUMAN 0.23364486/CHEMBL2023456
For the given ligand a, we have found in our database that, being scored 0.23364486, the most similar ligand is CHEMBL2023456. Check out the elaboration below.
| a (Given Ligand) | CHEMBL2023456 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Clc1ccc2c(ccnc2c1)c3cnn(c3)c4ccccc4 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00018006 40000a08 20004180 00010610 200c0000 00004008 04000000 00001000 00000100 000108c0 01000004 60008800 82000804 00400000 00020040 800c000c 00020040 82400000 04680100 00221000 40000040 18038128 20800800 83400010 00006001 80000000 00000000 00000040 04004080 10460009 40040000 804204a0 |