On Target 5HT2B_HUMAN 0.375/CHEMBL493128
For the given ligand a, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL493128. Check out the elaboration below.
| a (Given Ligand) | CHEMBL493128 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Cl.NC[C@H]1C[C@@H]1c2cccc(Cl)c2 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008000 05000200 00000102 00010600 00000000 00000000 04000000 00000000 00100800 000808c0 08100000 40018800 02000004 01200000 80000000 00000000 00000000 02000000 00000000 00000001 00000100 18000100 00000000 00440010 00002000 80000000 00000000 00000000 00000000 0006000a 00000000 00020400 |