On Target HRH1_HUMAN 0.26595744/CHEMBL105385
For the given ligand a, we have found in our database that, being scored 0.26595744, the most similar ligand is CHEMBL105385. Check out the elaboration below.
| a (Given Ligand) | CHEMBL105385 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | CCOC(=O)N1CCN(CCCOc2ccc(cc2)c3ccc(Cl)cc3)CC1 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0400a000 00402008 20100108 04010600 00001000 02010000 02040000 00000008 00800200 00000840 00200000 40008800 02808016 00002000 01000001 001a2008 00220000 02000000 04800800 00020200 00000000 38000d10 110000a1 02400018 00002001 80000002 00060000 00200060 08004200 00060001 80000000 01020240 |