On Target CCR2_HUMAN 0.2521739/CHEMBL337720
For the given ligand a, we have found in our database that, being scored 0.2521739, the most similar ligand is CHEMBL337720. Check out the elaboration below.
| a (Given Ligand) | CHEMBL337720 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | OC(=O)c1cc2c(cccc2n1Cc3ccc(Cl)c(Cl)c3)c4ccccc4 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0000a002 08001a00 00100100 50050600 00040020 0000e000 04000000 00001004 80500300 000008c0 00080004 60018800 82008844 00508000 80020040 020c000c 00028000 02800004 04280000 10000002 40000000 18068b78 30802002 8150000c 00002000 c0100000 00040040 00000040 04404004 00060049 c0040200 00020020 |