On Target 5HT1A_HUMAN 0.3116883/CHEMBL1255002
For the given ligand a, we have found in our database that, being scored 0.3116883, the most similar ligand is CHEMBL1255002. Check out the elaboration below.
| a (Given Ligand) | CHEMBL1255002 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Clc1cccc(Cl)c1OCCNCCOc2ccccc2OCc3ccccc3 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0400a000 00000008 20000108 00610602 00001080 00004020 02000000 00000000 00000100 00000840 00200000 40008800 02804006 00010400 01201001 02088008 10000000 02000000 01400000 00020000 00000000 08040120 12000000 00c01000 00002000 8000a800 00000000 00000001 00000200 00060008 40000000 00020280 |