On Target CXCR2_HUMAN 0.21929824/CHEMBL82566
For the given ligand a, we have found in our database that, being scored 0.21929824, the most similar ligand is CHEMBL82566. Check out the elaboration below.
| a (Given Ligand) | CHEMBL82566 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | Sc1nc(nn1Cc2cccc(Cl)c2)c3ccc(Cl)cc3Cl |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00008004 08800008 c0000100 00110600 01000040 00008024 04818200 08083000 00400100 00000843 04000008 40008800 02000805 00000401 80060000 0018204c 08008000 02002000 00400000 00200000 80080000 18018140 21000040 81404010 00006000 80000200 14048000 00000060 05c00115 00061000 80040a80 02030148 |