On Target MC5R_HUMAN 0.24561404/CHEMBL3940009
For the given ligand a, we have found in our database that, being scored 0.24561404, the most similar ligand is CHEMBL3940009. Check out the elaboration below.
| a (Given Ligand) | CHEMBL3940009 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | CC[C@H](CN1CC[C@H](CNC(=O)c2ccc(cc2)c3ccc(Cl)cc3)N[C@H](CCN4CCCCC4)C1=O)c5ccccc5 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 0002a000 01003c00 00100100 44010600 00000000 00000000 00000000 2200100c 00200980 000909e0 08300000 5003b800 86008806 00002001 80000400 00000000 00020000 02000000 04000000 10000201 08000100 382e8700 10000003 8350001c 00002000 c0000000 00040000 90000040 0c004100 00060013 a0044000 01822600 |