On Target AA2AR_HUMAN 0.125/CHEMBL603095
For the given ligand 123, we have found in our database that, being scored 0.125, the most similar ligand is CHEMBL603095. Check out the elaboration below.
| 123 (Given Ligand) | CHEMBL603095 (Similar Ligand) |
|---|---|
| c1ccccc1 | CN1C(=O)C=C2c3ccccc3C(=O)c4c(N)ccc1c24 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00000002 00800000 00004000 00000600 00040000 00000060 00000000 00000000 06000000 c00008e0 04000004 00018000 00008800 00600000 001000c0 00040004 00000000 00000008 00200000 00000000 40000000 18008018 20800000 80300000 02000000 40000000 00000040 00000000 00000000 00060000 00040000 00000000 |