On Target MC5R_HUMAN 0.08/CHEMBL3962265
For the given ligand 123, we have found in our database that, being scored 0.08, the most similar ligand is CHEMBL3962265. Check out the elaboration below.
| 123 (Given Ligand) | CHEMBL3962265 (Similar Ligand) |
|---|---|
| c1ccccc1 | CCC(CC)CN1CC[C@@H](CNC(=O)c2ccc3ccccc3c2)N[C@@H](CCN)C1=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00020000 01003c00 00100100 04010600 00000000 00000000 00000000 22001008 00200000 000109e0 00200000 4002b000 06008802 00002001 80000400 00000000 00000000 02000000 00000000 00000201 08000000 380e8608 00000003 0240001c 00000000 c0000000 00000000 90000000 08000100 00060011 a0044000 00002200 |