On Target HRH3_HUMAN 0.5625/CHEMBL209478
For the given ligand BP, we have found in our database that, being scored 0.5625, the most similar ligand is CHEMBL209478. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL209478 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | CN(C)Cc1ccc(-c2ccc(CN(C)C)cc2)cc1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00002000 00000000 00000100 00010600 00000000 00000000 00000000 02001000 00000100 00000840 00200000 40008000 80000800 00000000 00000000 00000000 00020000 02000000 04000000 10000000 00000000 08008000 10000000 00400000 00000000 80000000 00000000 80000040 00004100 00060000 00040000 00000200 |