On Target CNR1_HUMAN 0.375/CHEMBL3915185
For the given ligand BP, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL3915185. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL3915185 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | Cc1cccc(-c2ccc(C(C)(C)c3ccccc3)cc2O)c1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00002000 42000008 20000100 00010200 00000001 00000000 02000000 01000000 00000100 00080840 08000000 40008800 00400002 00000000 00000000 00002008 00020000 02001000 04000000 10020200 00000000 08000000 10000000 00424010 00000000 a0000000 10000000 40000041 00004080 00020002 00000200 00000400 |