On Target CNR2_HUMAN 0.38297874/CHEMBL32362
For the given ligand BP, we have found in our database that, being scored 0.38297874, the most similar ligand is CHEMBL32362. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL32362 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | CCCc1ccc(O)c(-c2cc(CCC)ccc2O)c1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00002000 00000008 20000100 00010200 00000001 20000000 02000000 00000000 00000800 00080840 08100000 40008000 00400002 00000000 00000000 00082008 00020000 02001000 04000000 00020001 00000100 08000000 11000000 00404010 00000000 80000080 10120000 00000041 00004000 00020002 00000200 00000400 |