On Target OPRX_HUMAN 0.22222222/CHEMBL53256
For the given ligand BP, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL53256. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL53256 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | CC(C)C1CCC(N2CCC3(CC2)C(c2ccccc2)C[C@H]2CN(C)C[C@H]23)CC1 |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00000000 01000000 00100102 00010600 00000000 00000010 00000000 20000000 00100800 000808c0 08300000 50018000 00000002 00200000 00000000 00000000 00000000 02000000 02002000 00000201 00000100 18000030 00000000 00500010 00000000 80000000 00000000 10000000 00000002 01060002 00020000 00002600 |