On Target MC5R_HUMAN 0.19354838/CHEMBL3964883
For the given ligand BP, we have found in our database that, being scored 0.19354838, the most similar ligand is CHEMBL3964883. Check out the elaboration below.
| BP (Given Ligand) | CHEMBL3964883 (Similar Ligand) |
|---|---|
| c2ccc(c1ccccc1)cc2 | NCCCC[C@@H]1N[C@H](CNC(=O)c2ccc(-c3ccccc3)cc2)CCN(Cc2ccc3ccccc3c2)C1=O |
|
|
|
|
|
|
| 00002000 00000000 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 40008000 00000000 00000000 00000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00012000 01803c00 00100100 44010600 00000000 00000000 00000000 22001008 00200100 000109e0 00200000 4003b000 8600880a 00002001 80000400 00000000 00020000 02000000 04002000 10000201 88000000 380e8638 10000003 0250001c 00000000 c0000000 00000000 90000040 08004100 00060011 a0044000 00002200 |