On Target EDNRA_HUMAN 0.37313432/CHEMBL315927
For the given ligand Cocaine, we have found in our database that, being scored 0.37313432, the most similar ligand is CHEMBL315927. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL315927 (Similar Ligand) |
|---|---|
| COC(=O)C2C(OC(=O)c1ccccc1)CC3CCC2N3C | CC(C)C[C@@H]1NC(=O)[C@H](NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)O)NC(=O)[C@@H](Cc3cccc4ccccc34)NC1=O)C(C)C |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00070000 01003200 00100100 04010600 00100000 00000010 00000000 2000000c 00000880 000808c0 08300000 4001b000 0e008012 00002001 80000000 000c0008 00000000 02000001 00c00018 00000201 00000100 38340e28 01000083 83500018 00001801 80000000 00000000 10000000 0c000002 0006000b 20004000 00802e00 |