On Target EDNRA_HUMAN 0.42920354/CHEMBL323951
For the given ligand Heroin, we have found in our database that, being scored 0.42920354, the most similar ligand is CHEMBL323951. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL323951 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CCCCN(CCCC)C(=O)CN1C[C@@H]([C@H]([C@@H]1CC(C)(C)\C=C/C)C(=O)O)c2ccc3OCOc3c2 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 00030000 43001208 2010010a 04010600 00181000 c0000010 02040000 20000400 10200880 001808c0 48300000 4001b000 0e02c00a 20a02000 81000401 002c8008 00004000 02000000 00c82018 00020201 00040300 38240e10 010080c1 83500018 40001801 80000000 00524000 b0000000 0d000202 0006000b 24024000 00812e00 |