On Target ACM5_HUMAN 0.42666668/CHEMBL2312366
For the given ligand Heroin, we have found in our database that, being scored 0.42666668, the most similar ligand is CHEMBL2312366. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL2312366 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CN1CCC(=C(C1)C(=O)OCCCc2ccc3OCCc3c2)c4ccccc4 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04041050 08008208 20100108 00010700 00001041 02000800 821c0180 30000640 01800800 005808c0 48300000 40009000 0c808102 00090000 01040003 000c3018 28220400 02000140 24c1801a 00820201 00000120 18000a80 010080c0 00400010 00001401 80000400 005a2000 50810404 00400300 0006040a 04000000 00002610 |