On Target AA2BR_HUMAN 0.30708662/CHEMBL589251
For the given ligand Heroin, we have found in our database that, being scored 0.30708662, the most similar ligand is CHEMBL589251. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL589251 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CN1C(=O)N(C)c2nc([nH]c2C1=O)c3ccc(OCCOCCOCCOCCOCCCCCCCCCCC=C)cc3 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 0400802a 01801808 20180108 12010700 00081060 0000c000 02049200 00080440 16402100 901018e0 0c00800c 40008800 02809022 00d01000 012a0481 080e900c 00800000 0200a000 00402002 00420001 80000120 38000040 25802041 08700014 00040400 c0200000 60020000 80840020 00004205 00460c00 e4020800 40000280 |