On Target HRH2_HUMAN 0.3768116/CHEMBL490632
For the given ligand Heroin, we have found in our database that, being scored 0.3768116, the most similar ligand is CHEMBL490632. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL490632 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | COc1c(OCCF)cccc1C(=O)C2CCN(CCc3ccc(C)cc3)CC2 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 06020000 43000808 2010010a 00210600 00001000 40020000 02000000 21000200 00100980 000808c0 08300000 50019840 0480c002 20200080 01004001 2208a008 00000000 02000000 00080400 00020201 00000100 18220200 00000000 81500414 00000000 c0000000 00000800 10000000 04000300 0006400a 80000000 00802600 |