On Target NPSR1_HUMAN 0.3255814/CHEMBL1801359
For the given ligand Heroin, we have found in our database that, being scored 0.3255814, the most similar ligand is CHEMBL1801359. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL1801359 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | COc1cccc2c3nccn3C(CC4CCOCC4)(c5ccc(Cl)cc5)c12 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 0000c102 41800208 2010030a 10810700 a0081060 00002100 02000400 01081600 80000900 100818c0 08108008 40018840 03001866 01a00000 018200a1 020d300c 10800480 0e002000 00482000 00422201 80100120 38008110 a1005040 83500411 00002400 e0000001 00040000 50014080 06000386 0046480a 420c0800 00020400 |