On Target MC4R_HUMAN 0.34686348/CHEMBL439361
For the given ligand Heroin, we have found in our database that, being scored 0.34686348, the most similar ligand is CHEMBL439361. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL439361 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CCCCC(=O)N[C@@H]1CC(=O)NCCCC[C@H](NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@H](Cc4ccccc4)NC(=O)C5(CCc6c(C5)cccc6OCC)NC1=O)C(=O)N |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04030002 43003e08 2010010a 45810e10 00041222 c0000002 03012000 2000020d 00700880 000909e2 08300014 4083b040 1e80881a 20602889 81000061 020c200c 00000a00 02008001 00282418 00020201 40000100 382c8638 20804003 93500418 00043800 c0000001 48010000 10000000 0c000302 0006c01b 20044200 00c02620 |