On Target ADRB3_HUMAN 0.41666666/CHEMBL59765
For the given ligand Heroin, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL59765. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL59765 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CCOC(=O)COc1ccc2CCC[C@@H](Cc2c1)NC[C@H](O)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04008000 57000008 2010010a 00010600 000010a0 c0004002 06040000 20000041 00102980 000808c0 08340000 4081c800 02808006 20200080 81280021 00080008 11020200 82000000 00082002 00020201 00000100 18200b20 06004000 89580010 00002400 80000001 00120008 10800020 04000202 00060002 40020000 00022600 |