On Target CCR1_HUMAN 0.37719297/CHEMBL2391937
For the given ligand Heroin, we have found in our database that, being scored 0.37719297, the most similar ligand is CHEMBL2391937. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL2391937 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | O[C@H](COc1ccccc1C(=O)NC2CC2)CN3CCC4(CC3)Cc5cc(Cl)ccc5O4 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04009000 05001808 2010010a 00010600 000010c0 02020100 06000000 22001640 00100810 001808c0 08300000 50018860 02808806 01200000 812c0401 00082018 18200000 22008400 04800000 00020201 00000140 18028700 07000080 0854001c 00002001 c0000000 00100800 90800000 00000300 00064003 a4040000 00022640 |