On Target ACM4_HUMAN 0.3846154/CHEMBL1346
For the given ligand Heroin, we have found in our database that, being scored 0.3846154, the most similar ligand is CHEMBL1346. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL1346 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | NC(=O)C([C@@H]1CCN(CCc2ccc3OCCc3c2)C1)(c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04031000 01000208 2010010a 00010600 00001041 02000010 02040000 21000240 00300880 000808c0 08300000 40039000 05808012 00200000 41040001 000c2018 08000000 02000000 04000000 00020201 00000100 18200620 01000000 81500010 00000000 a0000000 00120000 50800004 04000380 0006000a 00002000 00802600 |