On Target TAAR1_HUMAN 0.42083332/CHEMBL2136532
For the given ligand Heroin, we have found in our database that, being scored 0.42083332, the most similar ligand is CHEMBL2136532. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL2136532 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CCOC(=O)[C@]12CCCC=C1N(CCC3=CCCCC3)C(=O)[C@H](CC(=O)NCCc4ccccc4OC)C2 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 00430000 09001008 20900908 00210700 00081000 00100000 02080260 20000606 002004c0 001a88c8 08200240 51039080 0c02803a 01880000 01000405 00083048 90a30000 03000063 40c12010 00028201 00008020 18341e10 0100a080 81500018 04201401 c0000000 00404000 90040500 04100302 00060403 24020000 40802600 |