On Target 5HT5A_HUMAN 0.3828125/CHEMBL161507
For the given ligand Cocaine, we have found in our database that, being scored 0.3828125, the most similar ligand is CHEMBL161507. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL161507 (Similar Ligand) |
|---|---|
| COC(=O)C2C(OC(=O)c1ccccc1)CC3CCC2N3C | CCCN[C@@H]1CCc2c(cccc2C(=O)OC)[C@@H]1C |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00000000 01000a00 00100102 00010600 00001021 0000c402 00000000 20000001 00000980 00080ac0 28300000 40808800 00008002 00210000 00000020 0a0c0008 00020200 02000000 00002000 40000201 00400500 18220a60 01004000 81400014 00000000 80002201 00000000 10000000 04000203 0006000a c0000004 00002600 |