On Target HRH3_HUMAN 0.45/CHEMBL1935421
For the given ligand Heroin, we have found in our database that, being scored 0.45, the most similar ligand is CHEMBL1935421. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL1935421 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | C(Oc1ccc2OC3(CCN(CC3)C4CCC4)CCc2c1)C5CCCO5 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04000000 43000018 2010010a 00010700 00081000 c2000000 02000000 20000240 00002800 000808c0 08300000 50018040 00800002 22200090 11280001 0008a008 00a00000 22008000 00c82002 00020201 00000120 18000010 050000c0 08500010 00000401 c0000000 00080000 10800020 00000302 00064002 00000000 02002640 |