On Target AA1R_HUMAN 0.29476583/CHEMBL1090687
For the given ligand Heroin, we have found in our database that, being scored 0.29476583, the most similar ligand is CHEMBL1090687. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL1090687 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | Nc1sc2CN(CCCCCCCCCOc3ccc(Nc4ncnc5c4ncn5[C@@H]6O[C@H](CO)[C@@H](O)[C@H]6O)cc3)CCc2c1C(=O)c7ccc(Cl)c(Cl)c7 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 1401800a 05c11808 a218090a 9a090720 003810e0 0209c000 16008d90 2300580b 00402180 01882cf4 0c30820c c0819a94 068098be 03a811a1 910a34c1 183ee00c 11a41220 9200503d 19f0240a 9022d209 c08a1020 58a69bd0 27804044 0dd00014 1204e402 e4100012 0a054600 d00000f4 06028388 00460802 e02b0000 20c32ec0 |