On Target 5HT1F_HUMAN 0.2647059/CHEMBL497963
For the given ligand Heroin, we have found in our database that, being scored 0.2647059, the most similar ligand is CHEMBL497963. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL497963 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | Cc1ccc2c(OCCN3CCC(Cc4cccc(NS(=O)(=O)C)c4)CC3)cccc2n1 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04002002 01000008 2010410a 10310602 000410a0 00000000 06000000 20000008 00500800 000808c0 08302004 50018000 00800c02 00600801 810a1041 020e000c 10000000 02000004 00200000 00064201 40000100 18048808 32800000 80500010 00040080 80000000 00000040 1000000d 00400206 00060002 00040000 00250660 |