On Target GRM5_HUMAN 0.29674795/CHEMBL3805652
For the given ligand Heroin, we have found in our database that, being scored 0.29674795, the most similar ligand is CHEMBL3805652. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL3805652 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | COc1cccc(c1)[C@H]2OC(=O)N[C@@H]2c3cccc(c3)C#Cc4ccccc4 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 11000200 4ac25808 20100b0a 80090600 004030c1 c000c000 12000000 02001044 00400b00 00080848 08310000 40008004 00008802 20010100 01041005 021a0008 08020000 02000400 04080880 00020201 80000100 18b08c30 03000001 8340001c 00000004 80042002 18008000 80200004 04000300 00060003 c0040000 00000700 |