On Target GRM3_HUMAN 0.3019802/CHEMBL341457
For the given ligand Heroin, we have found in our database that, being scored 0.3019802, the most similar ligand is CHEMBL341457. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL341457 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | COc1cccc(CC[C@@](N)(C2C[C@@H]2C(=O)O)C(=O)O)c1 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 00030000 43000208 2000010a 00010600 00181000 40000000 02000000 00000000 00000800 000a08c0 08100000 4001b000 0400803a 23a00000 01000001 00080008 00000000 02000000 00482000 00020201 00000100 18000a00 03000000 00400010 00000000 80000000 00000000 00000000 00000202 0006000a 00020000 00400400 |