On Target GRM1_HUMAN 0.33846155/CHEMBL2111944
For the given ligand Heroin, we have found in our database that, being scored 0.33846155, the most similar ligand is CHEMBL2111944. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL2111944 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@]23C[C@H]2\C(=N/O)\c4ccccc4O3 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04012001 01005038 6390010a 00050f02 00481080 82001000 02000140 30006206 001109c0 000908c1 08350000 4001f040 0684800a 01200002 91281009 00082018 10820000 a2028000 00406008 00020201 00040100 18260e10 13000040 81500418 00000800 c0000000 40a00008 12000001 0404030b 00064003 60084000 00442601 |