On Target NPY5R_HUMAN 0.4632353/CHEMBL522913
For the given ligand Cocaine, we have found in our database that, being scored 0.4632353, the most similar ligand is CHEMBL522913. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL522913 (Similar Ligand) |
|---|---|
| COC(=O)C2C(OC(=O)c1ccccc1)CC3CCC2N3C | O=C1OC2(CCN(CC2)c3nc4ccccc4[nH]3)c5ccccc15 |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00000002 01000a00 00100100 00010600 00040050 0800c000 00000000 20100000 00000900 200808c0 09308004 50038800 00008002 00690000 00000040 020c000c 00220000 02004200 00a00000 00a00201 40400520 5c020b60 21804880 00700014 00000401 80002201 00080000 10000000 00000208 0046180e c0001000 02000680 |