On Target TSHR_HUMAN 0.29457363/CHEMBL3897841
For the given ligand Heroin, we have found in our database that, being scored 0.29457363, the most similar ligand is CHEMBL3897841. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL3897841 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CC(=O)N1CCC(C)(C2C=C(NC(=O)OC3CCCC3)C=CC12)c4ccccc4 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 00400030 09449200 0a100102 00110700 480e0000 00300001 00180000 a0000414 00000e00 001808ca 08340040 54418220 00028102 00210100 00002400 001e010c 20830000 03000142 40412880 00000201 00008900 18040e10 41008000 0050021a 00000000 80003002 00484800 90240100 10000200 010e140b ac000000 42012600 |