On Target GRM2_HUMAN 0.31759655/CHEMBL287831
For the given ligand Heroin, we have found in our database that, being scored 0.31759655, the most similar ligand is CHEMBL287831. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL287831 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CC1c2ccccc2Oc3cccc(c13)[C@](N)([C@H]4C[C@@H]4C(=O)O)C(=O)O |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 00030008 47000008 2040050a 10018600 00181041 40000002 02000400 01001201 00000804 000a08c0 08100000 4001b000 0500883a 23a00000 41040021 00082088 08000000 02000000 00582000 00020201 00400100 18008a00 03004008 06408010 00000000 e0000101 00000000 40210000 02000382 00060802 02062400 00400400 |