On Target OPRD_HUMAN 0.9132653/CHEMBL199931
For the given ligand Heroin, we have found in our database that, being scored 0.9132653, the most similar ligand is CHEMBL199931. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL199931 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CN1CC[C@]23[C@H]4Oc5c(OC(=O)CCCCCCCCC(=O)Oc6ccc7C[C@@H]8C9CCCC[C@]9(CCN8CC%10CCC%10)c7c6)ccc(C[C@@H]1[C@@H]2C=C[C@@H]4O)c35 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04011000 cb000208 20100d0a 80310700 00181061 c2000002 020c1000 38000643 00000890 001818ca 08300300 51819040 0482c20a 21a00090 11250425 020ca018 08820200 22008060 06492010 0002a201 00000100 18200a10 1500e040 89540410 02201000 c0002401 04524200 90800004 04000302 0007cc0a 24020000 10012f40 |