On Target 5HT7R_HUMAN 0.42060086/CHEMBL3581246
For the given ligand Heroin, we have found in our database that, being scored 0.42060086, the most similar ligand is CHEMBL3581246. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL3581246 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CCCCCCOc1cc2C[C@@H]3N(C)CCc4cc(OC)c(OC)c(c2cc1OC)c34 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04002008 47000009 20100108 10210700 000a1021 ca000002 02040000 02003001 00000880 10080840 08300000 40808000 00804892 20a00080 31000401 0208a008 00820240 82001020 04482002 00621201 00020100 18308000 11405020 8144c010 10800000 c0000081 10324000 80000041 04004300 1006040a 21441200 00002740 |