On Target 5HT4R_HUMAN 0.36734694/CHEMBL571799
For the given ligand Heroin, we have found in our database that, being scored 0.36734694, the most similar ligand is CHEMBL571799. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL571799 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CO[C@H]1CN(C[C@@H]2CCCC[C@@]2(O)c3cccc(OC)c3)CC[C@H]1NC(=O)c4cc(Cl)c(N)cc4OC |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 0000800a cb005e08 2010010a 80010700 00181080 40024100 06000000 22001400 00000900 001809e8 08300004 50018800 02008806 28a00000 81081445 000c2008 10000000 02000400 02c82000 00020601 40000100 180a8730 33000080 0050001c 00002001 c0000400 00900a00 90000001 00000302 0006081b e4060000 00022e00 |