On Target CXCR2_HUMAN 0.32589287/CHEMBL3645131
For the given ligand Heroin, we have found in our database that, being scored 0.32589287, the most similar ligand is CHEMBL3645131. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL3645131 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CC(CCc1ccccc1)Oc2c(ccc3ccccc23)C(=O)NC4(CCCC4)C(=O)O |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04018008 01005808 2010010a 00010700 00081080 02020100 02000000 22001400 00000800 001808c0 08300000 4001b020 0680880a 00a00000 11000401 00082008 10000000 22008000 00402000 00020201 00000140 18068e08 03000040 0050001c 00000000 c0000000 00000800 90000000 00000300 01060003 a4044000 00000600 |