On Target ADA1D_HUMAN 0.4057971/CHEMBL383938
For the given ligand Heroin, we have found in our database that, being scored 0.4057971, the most similar ligand is CHEMBL383938. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL383938 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | Cl.COc1ccc2CCCCc2c1OCCNC[C@H]3COc4ccccc4O3 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04002000 43000008 2010010a 00210602 00001080 c2000000 02040200 00000201 00002800 00080840 08300000 40008040 00804002 20200080 01281001 0208a008 10200200 02028000 00882002 00020201 00000100 18040000 17004080 08400410 00000001 c0000001 00120000 00800001 00000302 0006400a 00000000 000206c0 |