On Target NK1R_HUMAN 0.44725737/CHEMBL327606
For the given ligand Heroin, we have found in our database that, being scored 0.44725737, the most similar ligand is CHEMBL327606. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL327606 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | COc1ccc(OC(F)(F)F)cc1C2=CC3(CCCNC3c4ccccc4)OC2 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 00040040 4b000008 2011030a 80110700 003110d1 00000000 82080080 3a009640 00000804 001808ca 48300000 50518100 04020802 20200000 010c140b 00083008 18000410 02000040 1449201c 00020201 00010120 18008010 13008028 00500010 11001400 c0000400 00486200 d0000401 02400302 00060d03 24040000 02012f10 |