On Target NPBW1_HUMAN 0.29166666/CHEMBL1940539
For the given ligand Heroin, we have found in our database that, being scored 0.29166666, the most similar ligand is CHEMBL1940539. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL1940539 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | COc1ccc(cc1)C2(CCC2)N[C@@H]3CC[C@@H]([C@H](C3)c4ccsc4)C(=O)N5CCN(CC5)c6nc7ccccc7[nH]6 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 00010002 01002208 2010090a 85010600 00141040 00004000 02040000 22001008 00000900 200808c0 09308204 40019080 0400881a 00603011 01001441 001c000c 00000000 02004000 02202008 00a24601 40000100 7e8086b0 21800821 32700018 00004800 c4000000 00320000 90000004 0800031a 0046180b 60069000 00c12e80 |