On Target DRD5_HUMAN 0.42798355/CHEMBL3577346
For the given ligand Heroin, we have found in our database that, being scored 0.42798355, the most similar ligand is CHEMBL3577346. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL3577346 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CCCCn1cc(CCCOc2ccc(cc2OC)C(=O)NCCCCN(CCC)[C@H]3CCc4c(O)cccc4C3)nn1 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04000000 57001a18 6030010b 00a10718 00081020 c2000000 06042000 22001201 00200880 100808c0 08308000 40838840 0080ca86 00a02000 13014401 2a0ca00c 00000200 86000000 00482000 00060201 00020100 18268610 010050c0 8154801c 00200001 c2000001 00220000 90002000 04000306 0006c00b b0040000 0400a640 |