On Target CNR2_HUMAN 0.5323383/CHEMBL2348471
For the given ligand Heroin, we have found in our database that, being scored 0.5323383, the most similar ligand is CHEMBL2348471. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL2348471 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | CC(C)(C)C(=O)OCC1=CC[C@@H]2[C@@H](C1)c3c(O)cc(cc3OC2(C)C)C45CC6CC(CC(C6)C4)C5 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04040041 c3000018 2000010a 80110300 00181000 c2000800 42000000 08000602 00000900 0018084a 48100000 40009840 00828002 20a00080 11000401 00083008 00820000 22008020 22482010 00022a01 00000120 08000a00 01008040 00400410 00201400 c0002400 04404000 80000000 00010302 00034002 24020000 00810410 |