On Target HRH4_HUMAN 0.3497537/CHEMBL1934062
For the given ligand Heroin, we have found in our database that, being scored 0.3497537, the most similar ligand is CHEMBL1934062. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL1934062 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | C[C@H]1CCCN1[C@H](CCCOc2ccccc2)c3ccc(cc3)c4ccc(CN5CCCCC5)cc4 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04002000 01000008 2010010a 00010700 00181000 02000010 02000000 22001000 00000900 000808c0 08300000 50018800 80800802 00200000 11000401 00082008 00820000 02000000 04400000 10020201 00000100 18008000 11000000 00500010 00000000 c0000000 00000200 90000040 00004300 00060002 20040000 00002e00 |