On Target AA3R_HUMAN 0.5585586/CHEMBL80
For the given ligand Heroin, we have found in our database that, being scored 0.5585586, the most similar ligand is CHEMBL80. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL80 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | Oc1ccc2C[C@H]3N(CC=C)CC[C@@]45[C@@H](Oc1c24)C(=O)CC[C@@]35O |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04051000 43000208 2010050a 00210700 001810e1 c2000002 07001000 20008641 00050880 010818c0 08340000 d081d140 0480c01a 22a10080 110c0021 020ca018 18800200 a2008100 07482008 00020201 00000100 18200210 03004040 83500410 00000800 c0000001 001a0208 10000000 04000302 0006c80a 04020000 02002e40 |