On Target CLTR1_HUMAN 0.3426295/CHEMBL1214532
For the given ligand Heroin, we have found in our database that, being scored 0.3426295, the most similar ligand is CHEMBL1214532. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL1214532 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | COc1ccc(NS(=O)(=O)C(F)(F)F)cc1C[C@H]2[C@@H](CO)c3cc(\C=C\c4ccc5ccc(C)cc5n4)ccc3OC2(C)C |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 04000002 01000818 2010411a 10310f00 002c1061 82000000 82040080 08008608 00400800 00080840 08102104 40008140 81800c02 00608801 910e1043 020e280c 08000400 22008000 10600000 00024001 40000100 18008808 21800041 81410410 00040080 c2000001 00462048 c000020c 00404306 00274002 04040000 00010660 |