On Target 5HT1D_HUMAN 0.6036036/CHEMBL100086
For the given ligand Tramadol, we have found in our database that, being scored 0.6036036, the most similar ligand is CHEMBL100086. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL100086 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1cccc(CN2CCN(CC2)C3CCC(O)(CC3)c4ccc5OCOc5c4)c1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000000 4f000008 2010010a 04010600 00181000 40004000 02040000 22001000 00300900 000908c0 48300000 40018000 00004802 20a02000 01000405 00288008 00000000 02000000 02482000 00020201 00040300 38008030 01000021 02548010 40000000 c0000000 00520000 b0000000 09000302 00060002 40060000 00010e00 |